C42H46F2N2O4S — CID 5059977
1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenyl-1-(2-thiophen-2-ylethyl)urea (PubChem CID 5059977) has the molecular formula C42H46F2N2O4S and a molecular weight of 712.90 g/mol. Its IUPAC name is 1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenyl-1-(2-thiophen-2-ylethyl)urea.
| Compound Name | 1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenyl-1-(2-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 5059977 |
| Molecular Formula | C42H46F2N2O4S |
| Molecular Weight | 712.90 g/mol |
| Exact Mass | 712.31 |
| IUPAC Name | 1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenyl-1-(2-thiophen-2-ylethyl)urea |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(CCc2cccs2)C(=O)Nc2ccccc2)c2ccc(cc2C(=O)c2ccc(F)c(F)c2)CC(O)CC1 |
| InChI | InChI=1S/C42H46F2N2O4S/c1-28-8-6-20-41(2)36(34-16-13-29(24-32(47)15-12-28)25-35(34)39(48)30-14-17-37(43)38(44)26-30)18-21-42(41,50)27-46(22-19-33-11-7-23-51-33)40(49)45-31-9-4-3-5-10-31/h3-5,7-11,13-14,16-17,23,25-26,32,36,47,50H,6,12,15,18-22,24,27H2,1-2H3,(H,45,49) |
| InChIKey | JRSUNVKANAPCCB-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.90 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|