C39H45F3N2O3 — CID 4224361
(3,4-difluorophenyl)-[5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone (PubChem CID 4224361) has the molecular formula C39H45F3N2O3 and a molecular weight of 646.79 g/mol. Its IUPAC name is (3,4-difluorophenyl)-[5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone.
| Compound Name | (3,4-difluorophenyl)-[5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone |
|---|---|
| PubChem CID | 4224361 |
| Molecular Formula | C39H45F3N2O3 |
| Molecular Weight | 646.79 g/mol |
| Exact Mass | 646.34 |
| IUPAC Name | (3,4-difluorophenyl)-[5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN2CCN(c3ccc(F)cc3)CC2)c2ccc(cc2C(=O)c2ccc(F)c(F)c2)CC(O)CC1 |
| InChI | InChI=1S/C39H45F3N2O3/c1-26-4-3-16-38(2)34(15-17-39(38,47)25-43-18-20-44(21-19-43)30-10-8-29(40)9-11-30)32-13-6-27(22-31(45)12-5-26)23-33(32)37(46)28-7-14-35(41)36(42)24-28/h4,6-11,13-14,23-24,31,34,45,47H,3,5,12,15-22,25H2,1-2H3 |
| InChIKey | FCGKXVGYPDQZKO-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.79 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|