C38H47F2NO5S — CID 4249104
(3,4-difluorophenyl)-[5-[[2,3-dihydroxypropyl(2-thiophen-2-ylethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone (PubChem CID 4249104) has the molecular formula C38H47F2NO5S and a molecular weight of 667.86 g/mol. Its IUPAC name is (3,4-difluorophenyl)-[5-[[2,3-dihydroxypropyl(2-thiophen-2-ylethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone.
| Compound Name | (3,4-difluorophenyl)-[5-[[2,3-dihydroxypropyl(2-thiophen-2-ylethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone |
|---|---|
| PubChem CID | 4249104 |
| Molecular Formula | C38H47F2NO5S |
| Molecular Weight | 667.86 g/mol |
| Exact Mass | 667.31 |
| IUPAC Name | (3,4-difluorophenyl)-[5-[[2,3-dihydroxypropyl(2-thiophen-2-ylethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(CCc2cccs2)CC(O)CO)c2ccc(cc2C(=O)c2ccc(F)c(F)c2)CC(O)CC1 |
| InChI | InChI=1S/C38H47F2NO5S/c1-25-5-3-15-37(2)33(13-16-38(37,46)24-41(22-29(44)23-42)17-14-30-6-4-18-47-30)31-11-8-26(19-28(43)10-7-25)20-32(31)36(45)27-9-12-34(39)35(40)21-27/h4-6,8-9,11-12,18,20-21,28-29,33,42-44,46H,3,7,10,13-17,19,22-24H2,1-2H3 |
| InChIKey | GTURZTBMGDYFIL-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.86 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|