C37H40F3NO4S — CID 4285214
13'-hydroxy-6',10'-dimethyl-3-(2-thiophen-2-ylethyl)-17'-[3-(trifluoromethyl)benzoyl]spiro[1,3-oxazolidine-5,5'-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraene]-2-one (PubChem CID 4285214) has the molecular formula C37H40F3NO4S and a molecular weight of 651.79 g/mol. Its IUPAC name is 13'-hydroxy-6',10'-dimethyl-3-(2-thiophen-2-ylethyl)-17'-[3-(trifluoromethyl)benzoyl]spiro[1,3-oxazolidine-5,5'-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraene]-2-one.
| Compound Name | 13'-hydroxy-6',10'-dimethyl-3-(2-thiophen-2-ylethyl)-17'-[3-(trifluoromethyl)benzoyl]spiro[1,3-oxazolidine-5,5'-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraene]-2-one |
|---|---|
| PubChem CID | 4285214 |
| Molecular Formula | C37H40F3NO4S |
| Molecular Weight | 651.79 g/mol |
| Exact Mass | 651.26 |
| IUPAC Name | 13'-hydroxy-6',10'-dimethyl-3-(2-thiophen-2-ylethyl)-17'-[3-(trifluoromethyl)benzoyl]spiro[1,3-oxazolidine-5,5'-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraene]-2-one |
| SMILES | CC1=CCCC2(C)C(CCC23CN(CCc2cccs2)C(=O)O3)c2ccc(cc2C(=O)c2cccc(C(F)(F)F)c2)CC(O)CC1 |
| InChI | InChI=1S/C37H40F3NO4S/c1-24-6-4-16-35(2)32(14-17-36(35)23-41(34(44)45-36)18-15-29-9-5-19-46-29)30-13-11-25(20-28(42)12-10-24)21-31(30)33(43)26-7-3-8-27(22-26)37(38,39)40/h3,5-9,11,13,19,21-22,28,32,42H,4,10,12,14-18,20,23H2,1-2H3 |
| InChIKey | RVZPEXHXFSBRBM-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.79 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|