C37H41NO4S2 — CID 6725378
[(2S,5S,6S,13S)-5-(1,3-benzothiazol-2-ylsulfanylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(4-methoxyphenyl)methanone (PubChem CID 6725378) has the molecular formula C37H41NO4S2 and a molecular weight of 627.87 g/mol. Its IUPAC name is [(2S,5S,6S,13S)-5-(1,3-benzothiazol-2-ylsulfanylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(4-methoxyphenyl)methanone.
| Compound Name | [(2S,5S,6S,13S)-5-(1,3-benzothiazol-2-ylsulfanylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 6725378 |
| Molecular Formula | C37H41NO4S2 |
| Molecular Weight | 627.87 g/mol |
| Exact Mass | 627.25 |
| IUPAC Name | [(2S,5S,6S,13S)-5-(1,3-benzothiazol-2-ylsulfanylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2cc3ccc2[C@@H]2CC[C@@](O)(CSc4nc5ccccc5s4)[C@@]2(C)CCC=C(C)CC[C@H](O)C3)cc1 |
| InChI | InChI=1S/C37H41NO4S2/c1-24-7-6-19-36(2)31(18-20-37(36,41)23-43-35-38-32-8-4-5-9-33(32)44-35)29-17-11-25(21-27(39)14-10-24)22-30(29)34(40)26-12-15-28(42-3)16-13-26/h4-5,7-9,11-13,15-17,22,27,31,39,41H,6,10,14,18-21,23H2,1-3H3/t27-,31-,36-,37+/m0/s1 |
| InChIKey | SOBQVLSOCLBQNZ-IHSZVOJWSA-N |
| XLogP | 8.37 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.87 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|