C47H48F3NO5S — CID 3396306
naphthalen-2-yl N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)carbamate (PubChem CID 3396306) has the molecular formula C47H48F3NO5S and a molecular weight of 795.96 g/mol. Its IUPAC name is naphthalen-2-yl N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)carbamate.
| Compound Name | naphthalen-2-yl N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)carbamate |
|---|---|
| PubChem CID | 3396306 |
| Molecular Formula | C47H48F3NO5S |
| Molecular Weight | 795.96 g/mol |
| Exact Mass | 795.32 |
| IUPAC Name | naphthalen-2-yl N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)carbamate |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(CCc2cccs2)C(=O)Oc2ccc3ccccc3c2)c2ccc(cc2C(=O)c2cccc(C(F)(F)F)c2)CC(O)CC1 |
| InChI | InChI=1S/C47H48F3NO5S/c1-31-8-6-22-45(2)42(40-19-15-32(26-37(52)17-14-31)27-41(40)43(53)35-11-5-12-36(28-35)47(48,49)50)20-23-46(45,55)30-51(24-21-39-13-7-25-57-39)44(54)56-38-18-16-33-9-3-4-10-34(33)29-38/h3-5,7-13,15-16,18-19,25,27-29,37,42,52,55H,6,14,17,20-24,26,30H2,1-2H3 |
| InChIKey | KXFCAYBCZSKTTO-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.96 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|