C37H40F3NO5S — CID 3512919
13'-hydroxy-6',10'-dimethyl-17'-(5-methylthiophene-2-carbonyl)-3-[[4-(trifluoromethoxy)phenyl]methyl]spiro[1,3-oxazolidine-5,5'-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-diene]-2-one (PubChem CID 3512919) has the molecular formula C37H40F3NO5S and a molecular weight of 667.79 g/mol. Its IUPAC name is 13'-hydroxy-6',10'-dimethyl-17'-(5-methylthiophene-2-carbonyl)-3-[[4-(trifluoromethoxy)phenyl]methyl]spiro[1,3-oxazolidine-5,5'-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-diene]-2-one.
| Compound Name | 13'-hydroxy-6',10'-dimethyl-17'-(5-methylthiophene-2-carbonyl)-3-[[4-(trifluoromethoxy)phenyl]methyl]spiro[1,3-oxazolidine-5,5'-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-diene]-2-one |
|---|---|
| PubChem CID | 3512919 |
| Molecular Formula | C37H40F3NO5S |
| Molecular Weight | 667.79 g/mol |
| Exact Mass | 667.26 |
| IUPAC Name | 13'-hydroxy-6',10'-dimethyl-17'-(5-methylthiophene-2-carbonyl)-3-[[4-(trifluoromethoxy)phenyl]methyl]spiro[1,3-oxazolidine-5,5'-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-diene]-2-one |
| SMILES | Cc1ccc(C(=O)C2=CC34C=CC25C(CCC2(C)C5CCC25CN(Cc2ccc(OC(F)(F)F)cc2)C(=O)O5)C3(C)CCC(O)C4)s1 |
| InChI | InChI=1S/C37H40F3NO5S/c1-22-4-9-27(47-22)30(43)26-19-34-16-17-36(26)28(32(34,2)13-10-24(42)18-34)11-14-33(3)29(36)12-15-35(33)21-41(31(44)46-35)20-23-5-7-25(8-6-23)45-37(38,39)40/h4-9,16-17,19,24,28-29,42H,10-15,18,20-21H2,1-3H3 |
| InChIKey | DYODWCDEAKBWOL-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.79 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|