C37H44F3NO6S2 — CID 3633446
N-[[5,13-dihydroxy-6,10-dimethyl-17-(5-methylthiophene-2-carbonyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]methanesulfonamide (PubChem CID 3633446) has the molecular formula C37H44F3NO6S2 and a molecular weight of 719.89 g/mol. Its IUPAC name is N-[[5,13-dihydroxy-6,10-dimethyl-17-(5-methylthiophene-2-carbonyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]methanesulfonamide.
| Compound Name | N-[[5,13-dihydroxy-6,10-dimethyl-17-(5-methylthiophene-2-carbonyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 3633446 |
| Molecular Formula | C37H44F3NO6S2 |
| Molecular Weight | 719.89 g/mol |
| Exact Mass | 719.26 |
| IUPAC Name | N-[[5,13-dihydroxy-6,10-dimethyl-17-(5-methylthiophene-2-carbonyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]methanesulfonamide |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(Cc2ccc(OC(F)(F)F)cc2)S(C)(=O)=O)c2ccc(cc2C(=O)c2ccc(C)s2)CC(O)CC1 |
| InChI | InChI=1S/C37H44F3NO6S2/c1-24-6-5-18-35(3)32(30-15-11-27(20-28(42)12-7-24)21-31(30)34(43)33-16-8-25(2)48-33)17-19-36(35,44)23-41(49(4,45)46)22-26-9-13-29(14-10-26)47-37(38,39)40/h6,8-11,13-16,21,28,32,42,44H,5,7,12,17-20,22-23H2,1-4H3 |
| InChIKey | MBBACEPCEIIKPZ-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.89 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|