C39H49ClFNO5S — CID 4052695
2-(2-chloro-6-fluorophenyl)-1-[5-[[2,3-dihydroxypropyl(2-thiophen-2-ylethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]ethanone (PubChem CID 4052695) has the molecular formula C39H49ClFNO5S and a molecular weight of 698.34 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-1-[5-[[2,3-dihydroxypropyl(2-thiophen-2-ylethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]ethanone.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-1-[5-[[2,3-dihydroxypropyl(2-thiophen-2-ylethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]ethanone |
|---|---|
| PubChem CID | 4052695 |
| Molecular Formula | C39H49ClFNO5S |
| Molecular Weight | 698.34 g/mol |
| Exact Mass | 697.30 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-1-[5-[[2,3-dihydroxypropyl(2-thiophen-2-ylethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]ethanone |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(CCc2cccs2)CC(O)CO)c2ccc(cc2C(=O)Cc2c(F)cccc2Cl)CC(O)CC1 |
| InChI | InChI=1S/C39H49ClFNO5S/c1-26-6-4-16-38(2)34(14-17-39(38,47)25-42(23-29(45)24-43)18-15-30-7-5-19-48-30)31-13-11-27(20-28(44)12-10-26)21-32(31)37(46)22-33-35(40)8-3-9-36(33)41/h3,5-9,11,13,19,21,28-29,34,43-45,47H,4,10,12,14-18,20,22-25H2,1-2H3 |
| InChIKey | ZHGMUDDUBMGSEX-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.34 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|