C48H50ClFN2O4 — CID 4094389
1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(naphthalen-1-ylmethyl)-3-phenylurea (PubChem CID 4094389) has the molecular formula C48H50ClFN2O4 and a molecular weight of 773.39 g/mol. Its IUPAC name is 1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(naphthalen-1-ylmethyl)-3-phenylurea.
| Compound Name | 1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(naphthalen-1-ylmethyl)-3-phenylurea |
|---|---|
| PubChem CID | 4094389 |
| Molecular Formula | C48H50ClFN2O4 |
| Molecular Weight | 773.39 g/mol |
| Exact Mass | 772.34 |
| IUPAC Name | 1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(naphthalen-1-ylmethyl)-3-phenylurea |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(Cc2cccc3ccccc23)C(=O)Nc2ccccc2)c2ccc(cc2C(=O)Cc2c(F)cccc2Cl)CC(O)CC1 |
| InChI | InChI=1S/C48H50ClFN2O4/c1-32-11-10-25-47(2)42(39-23-21-33(27-37(53)22-20-32)28-40(39)45(54)29-41-43(49)18-9-19-44(41)50)24-26-48(47,56)31-52(46(55)51-36-15-4-3-5-16-36)30-35-14-8-13-34-12-6-7-17-38(34)35/h3-9,11-19,21,23,28,37,42,53,56H,10,20,22,24-27,29-31H2,1-2H3,(H,51,55) |
| InChIKey | QDVKAQOAQSPIGH-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.39 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|