C38H45ClFNO5S — CID 5105763
N-benzyl-N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]methanesulfonamide (PubChem CID 5105763) has the molecular formula C38H45ClFNO5S and a molecular weight of 682.30 g/mol. Its IUPAC name is N-benzyl-N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]methanesulfonamide.
| Compound Name | N-benzyl-N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 5105763 |
| Molecular Formula | C38H45ClFNO5S |
| Molecular Weight | 682.30 g/mol |
| Exact Mass | 681.27 |
| IUPAC Name | N-benzyl-N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]methanesulfonamide |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(Cc2ccccc2)S(C)(=O)=O)c2ccc(cc2C(=O)Cc2c(F)cccc2Cl)CC(O)CC1 |
| InChI | InChI=1S/C38H45ClFNO5S/c1-26-9-8-19-37(2)33(18-20-38(37,44)25-41(47(3,45)46)24-27-10-5-4-6-11-27)30-17-15-28(21-29(42)16-14-26)22-31(30)36(43)23-32-34(39)12-7-13-35(32)40/h4-7,9-13,15,17,22,29,33,42,44H,8,14,16,18-21,23-25H2,1-3H3 |
| InChIKey | SDGFENNDLIQQEB-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.30 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|