About [4-(trifluoromethyl)phenyl]methyl 2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetate
[4-(trifluoromethyl)phenyl]methyl 2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetate (PubChem CID 33071387) has the molecular formula C18H14F3NO4
and a molecular weight of 365.31 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl]methyl 2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetate.
Molecular Properties
| Compound Name | [4-(trifluoromethyl)phenyl]methyl 2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetate |
| PubChem CID | 33071387 |
| Molecular Formula | C18H14F3NO4 |
| Molecular Weight | 365.31 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | [4-(trifluoromethyl)phenyl]methyl 2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetate |
| SMILES | O=C(C[C@H]1Oc2ccccc2NC1=O)OCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H14F3NO4/c19-18(20,21)12-7-5-11(6-8-12)10-25-16(23)9-15-17(24)22-13-3-1-2-4-14(13)26-15/h1-8,15H,9-10H2,(H,22,24)/t15-/m1/s1 |
| InChIKey | FMGQHHBOGWKNPN-OAHLLOKOSA-N |
| XLogP | 3.54 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.31 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(trifluoromethyl)phenyl]methyl 2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(trifluoromethyl)phenyl]methyl 2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetate?
The IUPAC name of [4-(trifluoromethyl)phenyl]methyl 2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetate (CID 33071387) is [4-(trifluoromethyl)phenyl]methyl 2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetate.
What is the SMILES notation for [4-(trifluoromethyl)phenyl]methyl 2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetate?
The canonical SMILES for [4-(trifluoromethyl)phenyl]methyl 2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetate is O=C(C[C@H]1Oc2ccccc2NC1=O)OCc1ccc(C(F)(F)F)cc1.
What is the InChIKey of [4-(trifluoromethyl)phenyl]methyl 2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetate?
The InChIKey is FMGQHHBOGWKNPN-OAHLLOKOSA-N. The full InChI is InChI=1S/C18H14F3NO4/c19-18(20,21)12-7-5-11(6-8-12)10-25-16(23)9-15-17(24)22-13-3-1-2-4-14(13)26-15/h1-8,15H,9-10H2,(H,22,24)/t15-/m1/s1.
What are the key properties of [4-(trifluoromethyl)phenyl]methyl 2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetate?
[4-(trifluoromethyl)phenyl]methyl 2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetate has a molecular weight of 365.31 g/mol, XLogP of 3.54, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(trifluoromethyl)phenyl]methyl 2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetate is sourced from PubChem (CID 33071387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).