C20H21NO5 — CID 42918596
2-(2,6-dimethylphenoxy)ethyl 2-(3-oxo-4H-1,4-benzoxazin-2-yl)acetate (PubChem CID 42918596) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-(2,6-dimethylphenoxy)ethyl 2-(3-oxo-4H-1,4-benzoxazin-2-yl)acetate.
| Compound Name | 2-(2,6-dimethylphenoxy)ethyl 2-(3-oxo-4H-1,4-benzoxazin-2-yl)acetate |
|---|---|
| PubChem CID | 42918596 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-(2,6-dimethylphenoxy)ethyl 2-(3-oxo-4H-1,4-benzoxazin-2-yl)acetate |
| SMILES | Cc1cccc(C)c1OCCOC(=O)CC1Oc2ccccc2NC1=O |
| InChI | InChI=1S/C20H21NO5/c1-13-6-5-7-14(2)19(13)25-11-10-24-18(22)12-17-20(23)21-15-8-3-4-9-16(15)26-17/h3-9,17H,10-12H2,1-2H3,(H,21,23) |
| InChIKey | LTOXWRDXCPKKJC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|