C26H35N3O4 — CID 33079907
N-benzyl-N-tert-butyl-2-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]acetamide (PubChem CID 33079907) has the molecular formula C26H35N3O4 and a molecular weight of 453.58 g/mol. Its IUPAC name is N-benzyl-N-tert-butyl-2-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]acetamide.
| Compound Name | N-benzyl-N-tert-butyl-2-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 33079907 |
| Molecular Formula | C26H35N3O4 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | N-benzyl-N-tert-butyl-2-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]acetamide |
| SMILES | COc1ccc(C(=O)N2CCN(CC(=O)N(Cc3ccccc3)C(C)(C)C)CC2)cc1OC |
| InChI | InChI=1S/C26H35N3O4/c1-26(2,3)29(18-20-9-7-6-8-10-20)24(30)19-27-13-15-28(16-14-27)25(31)21-11-12-22(32-4)23(17-21)33-5/h6-12,17H,13-16,18-19H2,1-5H3 |
| InChIKey | ORGOVVPSPVOXFK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |