C10H14N4O5 — CID 3308544
2-methyl-2-[(6-methyl-3,5-dinitro-2-pyridinyl)amino]propan-1-ol (PubChem CID 3308544) has the molecular formula C10H14N4O5 and a molecular weight of 270.25 g/mol. Its IUPAC name is 2-methyl-2-[(6-methyl-3,5-dinitro-2-pyridinyl)amino]propan-1-ol.
| Compound Name | 2-methyl-2-[(6-methyl-3,5-dinitro-2-pyridinyl)amino]propan-1-ol |
|---|---|
| PubChem CID | 3308544 |
| Molecular Formula | C10H14N4O5 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-methyl-2-[(6-methyl-3,5-dinitro-2-pyridinyl)amino]propan-1-ol |
| SMILES | Cc1nc(NC(C)(C)CO)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H14N4O5/c1-6-7(13(16)17)4-8(14(18)19)9(11-6)12-10(2,3)5-15/h4,15H,5H2,1-3H3,(H,11,12) |
| InChIKey | MJXPPQNZCOFDDJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 131.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|