About 2-methyl-2-[(6-methyl-3,5-dinitro-2-pyridinyl)amino]propan-1-ol
2-methyl-2-[(6-methyl-3,5-dinitro-2-pyridinyl)amino]propan-1-ol (PubChem CID 3308544) has the molecular formula C10H14N4O5
and a molecular weight of 270.25 g/mol. Its IUPAC name is 2-methyl-2-[(6-methyl-3,5-dinitro-2-pyridinyl)amino]propan-1-ol.
Molecular Properties
| Compound Name | 2-methyl-2-[(6-methyl-3,5-dinitro-2-pyridinyl)amino]propan-1-ol |
| PubChem CID | 3308544 |
| Molecular Formula | C10H14N4O5 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-methyl-2-[(6-methyl-3,5-dinitro-2-pyridinyl)amino]propan-1-ol |
| SMILES | Cc1nc(NC(C)(C)CO)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H14N4O5/c1-6-7(13(16)17)4-8(14(18)19)9(11-6)12-10(2,3)5-15/h4,15H,5H2,1-3H3,(H,11,12) |
| InChIKey | MJXPPQNZCOFDDJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 131.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-2-[(6-methyl-3,5-dinitro-2-pyridinyl)amino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-[(6-methyl-3,5-dinitro-2-pyridinyl)amino]propan-1-ol?
The IUPAC name of 2-methyl-2-[(6-methyl-3,5-dinitro-2-pyridinyl)amino]propan-1-ol (CID 3308544) is 2-methyl-2-[(6-methyl-3,5-dinitro-2-pyridinyl)amino]propan-1-ol.
What is the SMILES notation for 2-methyl-2-[(6-methyl-3,5-dinitro-2-pyridinyl)amino]propan-1-ol?
The canonical SMILES for 2-methyl-2-[(6-methyl-3,5-dinitro-2-pyridinyl)amino]propan-1-ol is Cc1nc(NC(C)(C)CO)c([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of 2-methyl-2-[(6-methyl-3,5-dinitro-2-pyridinyl)amino]propan-1-ol?
The InChIKey is MJXPPQNZCOFDDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O5/c1-6-7(13(16)17)4-8(14(18)19)9(11-6)12-10(2,3)5-15/h4,15H,5H2,1-3H3,(H,11,12).
What are the key properties of 2-methyl-2-[(6-methyl-3,5-dinitro-2-pyridinyl)amino]propan-1-ol?
2-methyl-2-[(6-methyl-3,5-dinitro-2-pyridinyl)amino]propan-1-ol has a molecular weight of 270.25 g/mol, XLogP of 1.39, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-[(6-methyl-3,5-dinitro-2-pyridinyl)amino]propan-1-ol is sourced from PubChem (CID 3308544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).