C30H27FN2O4 — CID 3311320
N-[2-[benzyl-[(6-methyl-4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-4-fluoro-N-prop-2-enylbenzamide (PubChem CID 3311320) has the molecular formula C30H27FN2O4 and a molecular weight of 498.55 g/mol. Its IUPAC name is N-[2-[benzyl-[(6-methyl-4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-4-fluoro-N-prop-2-enylbenzamide.
| Compound Name | N-[2-[benzyl-[(6-methyl-4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-4-fluoro-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 3311320 |
| Molecular Formula | C30H27FN2O4 |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | N-[2-[benzyl-[(6-methyl-4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-4-fluoro-N-prop-2-enylbenzamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccccc1)Cc1coc2ccc(C)cc2c1=O)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C30H27FN2O4/c1-3-15-32(30(36)23-10-12-25(31)13-11-23)19-28(34)33(17-22-7-5-4-6-8-22)18-24-20-37-27-14-9-21(2)16-26(27)29(24)35/h3-14,16,20H,1,15,17-19H2,2H3 |
| InChIKey | OTNSBRYIPDESNE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|