C22H26N2O3 — CID 33117205
1-(furan-2-ylmethyl)-2,5-dimethyl-N-(3-phenylmethoxypropyl)pyrrole-3-carboxamide (PubChem CID 33117205) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-2,5-dimethyl-N-(3-phenylmethoxypropyl)pyrrole-3-carboxamide.
| Compound Name | 1-(furan-2-ylmethyl)-2,5-dimethyl-N-(3-phenylmethoxypropyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 33117205 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 1-(furan-2-ylmethyl)-2,5-dimethyl-N-(3-phenylmethoxypropyl)pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCOCc2ccccc2)c(C)n1Cc1ccco1 |
| InChI | InChI=1S/C22H26N2O3/c1-17-14-21(18(2)24(17)15-20-10-6-13-27-20)22(25)23-11-7-12-26-16-19-8-4-3-5-9-19/h3-6,8-10,13-14H,7,11-12,15-16H2,1-2H3,(H,23,25) |
| InChIKey | SWTZNFBROBBUIP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|