C14H17NO4S — CID 3313792
methyl 4-(benzenesulfonyl)-5-(dimethylamino)penta-2,4-dienoate (PubChem CID 3313792) has the molecular formula C14H17NO4S and a molecular weight of 295.36 g/mol. Its IUPAC name is methyl 4-(benzenesulfonyl)-5-(dimethylamino)penta-2,4-dienoate.
| Compound Name | methyl 4-(benzenesulfonyl)-5-(dimethylamino)penta-2,4-dienoate |
|---|---|
| PubChem CID | 3313792 |
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | methyl 4-(benzenesulfonyl)-5-(dimethylamino)penta-2,4-dienoate |
| SMILES | COC(=O)C=CC(=CN(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H17NO4S/c1-15(2)11-13(9-10-14(16)19-3)20(17,18)12-7-5-4-6-8-12/h4-11H,1-3H3 |
| InChIKey | HECVEXYWIBUKDB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|