C27H47NO — CID 3313801
2-(1-adamantyl)-1-(2,2,3,3,4,4,5,5,6,6-decamethylpiperidin-1-yl)ethanone (PubChem CID 3313801) has the molecular formula C27H47NO and a molecular weight of 401.68 g/mol. Its IUPAC name is 2-(1-adamantyl)-1-(2,2,3,3,4,4,5,5,6,6-decamethylpiperidin-1-yl)ethanone.
| Compound Name | 2-(1-adamantyl)-1-(2,2,3,3,4,4,5,5,6,6-decamethylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 3313801 |
| Molecular Formula | C27H47NO |
| Molecular Weight | 401.68 g/mol |
| Exact Mass | 401.37 |
| IUPAC Name | 2-(1-adamantyl)-1-(2,2,3,3,4,4,5,5,6,6-decamethylpiperidin-1-yl)ethanone |
| SMILES | CC1(C)N(C(=O)CC23CC4CC(CC(C4)C2)C3)C(C)(C)C(C)(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C27H47NO/c1-22(2)23(3,4)25(7,8)28(26(9,10)24(22,5)6)21(29)17-27-14-18-11-19(15-27)13-20(12-18)16-27/h18-20H,11-17H2,1-10H3 |
| InChIKey | GCFITOOEGOKKAH-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.68 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |