C26H30N4O2S — CID 33163913
2-[(2-benzylanilino)methyl]-N,N-dimethyl-1-propylbenzimidazole-5-sulfonamide (PubChem CID 33163913) has the molecular formula C26H30N4O2S and a molecular weight of 462.62 g/mol. Its IUPAC name is 2-[(2-benzylanilino)methyl]-N,N-dimethyl-1-propylbenzimidazole-5-sulfonamide.
| Compound Name | 2-[(2-benzylanilino)methyl]-N,N-dimethyl-1-propylbenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 33163913 |
| Molecular Formula | C26H30N4O2S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 2-[(2-benzylanilino)methyl]-N,N-dimethyl-1-propylbenzimidazole-5-sulfonamide |
| SMILES | CCCn1c(CNc2ccccc2Cc2ccccc2)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C26H30N4O2S/c1-4-16-30-25-15-14-22(33(31,32)29(2)3)18-24(25)28-26(30)19-27-23-13-9-8-12-21(23)17-20-10-6-5-7-11-20/h5-15,18,27H,4,16-17,19H2,1-3H3 |
| InChIKey | MOAOTOPYARJHGO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |