C19H18Cl2N3O+ — CID 3319627
3-(3,5-dichlorophenyl)imino-1-(pyrrolidin-1-ium-1-ylmethyl)indol-2-one (PubChem CID 3319627) has the molecular formula C19H18Cl2N3O+ and a molecular weight of 375.28 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)imino-1-(pyrrolidin-1-ium-1-ylmethyl)indol-2-one.
| Compound Name | 3-(3,5-dichlorophenyl)imino-1-(pyrrolidin-1-ium-1-ylmethyl)indol-2-one |
|---|---|
| PubChem CID | 3319627 |
| Molecular Formula | C19H18Cl2N3O+ |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 3-(3,5-dichlorophenyl)imino-1-(pyrrolidin-1-ium-1-ylmethyl)indol-2-one |
| SMILES | O=C1/C(=N/c2cc(Cl)cc(Cl)c2)c2ccccc2N1C[NH+]1CCCC1 |
| InChI | InChI=1S/C19H17Cl2N3O/c20-13-9-14(21)11-15(10-13)22-18-16-5-1-2-6-17(16)24(19(18)25)12-23-7-3-4-8-23/h1-2,5-6,9-11H,3-4,7-8,12H2/p+1/b22-18+ |
| InChIKey | MRHSCHNYYVXGSC-RELWKKBWSA-O |
| XLogP | 3.10 |
| TPSA | 37.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|