C18H15ClN4 — CID 3319637
2-amino-6-(4-chlorophenyl)-5-methyl-4-(1-methylpyrrol-2-yl)pyridine-3-carbonitrile (PubChem CID 3319637) has the molecular formula C18H15ClN4 and a molecular weight of 322.80 g/mol. Its IUPAC name is 2-amino-6-(4-chlorophenyl)-5-methyl-4-(1-methylpyrrol-2-yl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-6-(4-chlorophenyl)-5-methyl-4-(1-methylpyrrol-2-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3319637 |
| Molecular Formula | C18H15ClN4 |
| Molecular Weight | 322.80 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 2-amino-6-(4-chlorophenyl)-5-methyl-4-(1-methylpyrrol-2-yl)pyridine-3-carbonitrile |
| SMILES | Cc1c(-c2ccc(Cl)cc2)nc(N)c(C#N)c1-c1cccn1C |
| InChI | InChI=1S/C18H15ClN4/c1-11-16(15-4-3-9-23(15)2)14(10-20)18(21)22-17(11)12-5-7-13(19)8-6-12/h3-9H,1-2H3,(H2,21,22) |
| InChIKey | NUDQXZRVHZNEIZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.80 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |