C24H29N3O6S2 — CID 3320086
[4-(dimethylsulfamoyl)phenyl]-[1-(3-morpholin-4-ium-4-ylpropyl)-4,5-dioxo-2-thiophen-2-ylpyrrolidin-3-ylidene]methanolate (PubChem CID 3320086) has the molecular formula C24H29N3O6S2 and a molecular weight of 519.65 g/mol. Its IUPAC name is [4-(dimethylsulfamoyl)phenyl]-[1-(3-morpholin-4-ium-4-ylpropyl)-4,5-dioxo-2-thiophen-2-ylpyrrolidin-3-ylidene]methanolate.
| Compound Name | [4-(dimethylsulfamoyl)phenyl]-[1-(3-morpholin-4-ium-4-ylpropyl)-4,5-dioxo-2-thiophen-2-ylpyrrolidin-3-ylidene]methanolate |
|---|---|
| PubChem CID | 3320086 |
| Molecular Formula | C24H29N3O6S2 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | [4-(dimethylsulfamoyl)phenyl]-[1-(3-morpholin-4-ium-4-ylpropyl)-4,5-dioxo-2-thiophen-2-ylpyrrolidin-3-ylidene]methanolate |
| SMILES | CN(C)S(=O)(=O)c1ccc(C([O-])=C2C(=O)C(=O)N(CCC[NH+]3CCOCC3)C2c2cccs2)cc1 |
| InChI | InChI=1S/C24H29N3O6S2/c1-25(2)35(31,32)18-8-6-17(7-9-18)22(28)20-21(19-5-3-16-34-19)27(24(30)23(20)29)11-4-10-26-12-14-33-15-13-26/h3,5-9,16,21,28H,4,10-15H2,1-2H3 |
| InChIKey | RPJUMAUCSPIONY-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|