C23H27N2O5S+ — CID 4752973
4-[hydroxy-(3-methoxyphenyl)methylidene]-1-(3-morpholin-4-ium-4-ylpropyl)-5-thiophen-2-ylpyrrolidine-2,3-dione (PubChem CID 4752973) has the molecular formula C23H27N2O5S+ and a molecular weight of 443.55 g/mol. Its IUPAC name is 4-[hydroxy-(3-methoxyphenyl)methylidene]-1-(3-morpholin-4-ium-4-ylpropyl)-5-thiophen-2-ylpyrrolidine-2,3-dione.
| Compound Name | 4-[hydroxy-(3-methoxyphenyl)methylidene]-1-(3-morpholin-4-ium-4-ylpropyl)-5-thiophen-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4752973 |
| Molecular Formula | C23H27N2O5S+ |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 4-[hydroxy-(3-methoxyphenyl)methylidene]-1-(3-morpholin-4-ium-4-ylpropyl)-5-thiophen-2-ylpyrrolidine-2,3-dione |
| SMILES | COc1cccc(C(O)=C2C(=O)C(=O)N(CCC[NH+]3CCOCC3)C2c2cccs2)c1 |
| InChI | InChI=1S/C23H26N2O5S/c1-29-17-6-2-5-16(15-17)21(26)19-20(18-7-3-14-31-18)25(23(28)22(19)27)9-4-8-24-10-12-30-13-11-24/h2-3,5-7,14-15,20,26H,4,8-13H2,1H3/p+1 |
| InChIKey | HUASGRHZLIHGOR-UHFFFAOYSA-O |
| XLogP | 1.48 |
| TPSA | 80.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|