C21H25N2O4S+ — CID 4752914
3-[4-[hydroxy-(3-methoxyphenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]propyl-dimethylazanium (PubChem CID 4752914) has the molecular formula C21H25N2O4S+ and a molecular weight of 401.51 g/mol. Its IUPAC name is 3-[4-[hydroxy-(3-methoxyphenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]propyl-dimethylazanium.
| Compound Name | 3-[4-[hydroxy-(3-methoxyphenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]propyl-dimethylazanium |
|---|---|
| PubChem CID | 4752914 |
| Molecular Formula | C21H25N2O4S+ |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 3-[4-[hydroxy-(3-methoxyphenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]propyl-dimethylazanium |
| SMILES | COc1cccc(C(O)=C2C(=O)C(=O)N(CCC[NH+](C)C)C2c2cccs2)c1 |
| InChI | InChI=1S/C21H24N2O4S/c1-22(2)10-6-11-23-18(16-9-5-12-28-16)17(20(25)21(23)26)19(24)14-7-4-8-15(13-14)27-3/h4-5,7-9,12-13,18,24H,6,10-11H2,1-3H3/p+1 |
| InChIKey | RYODNAMSMWNZQR-UHFFFAOYSA-O |
| XLogP | 1.71 |
| TPSA | 71.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|