C22H26N3O4+ — CID 6964370
3-[(5R)-4-[hydroxy-(3-methoxyphenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]propyl-dimethylazanium (PubChem CID 6964370) has the molecular formula C22H26N3O4+ and a molecular weight of 396.47 g/mol. Its IUPAC name is 3-[(5R)-4-[hydroxy-(3-methoxyphenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]propyl-dimethylazanium.
| Compound Name | 3-[(5R)-4-[hydroxy-(3-methoxyphenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]propyl-dimethylazanium |
|---|---|
| PubChem CID | 6964370 |
| Molecular Formula | C22H26N3O4+ |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 3-[(5R)-4-[hydroxy-(3-methoxyphenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]propyl-dimethylazanium |
| SMILES | COc1cccc(C(O)=C2C(=O)C(=O)N(CCC[NH+](C)C)[C@@H]2c2cccnc2)c1 |
| InChI | InChI=1S/C22H25N3O4/c1-24(2)11-6-12-25-19(16-8-5-10-23-14-16)18(21(27)22(25)28)20(26)15-7-4-9-17(13-15)29-3/h4-5,7-10,13-14,19,26H,6,11-12H2,1-3H3/p+1/t19-/m1/s1 |
| InChIKey | IOBYKEWSHYWCSZ-LJQANCHMSA-O |
| XLogP | 1.05 |
| TPSA | 84.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|