C22H24N3O5+ — CID 7072329
3-[(4Z,5R)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]propyl-dimethylazanium (PubChem CID 7072329) has the molecular formula C22H24N3O5+ and a molecular weight of 410.45 g/mol. Its IUPAC name is 3-[(4Z,5R)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]propyl-dimethylazanium.
| Compound Name | 3-[(4Z,5R)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7072329 |
| Molecular Formula | C22H24N3O5+ |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 3-[(4Z,5R)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]propyl-dimethylazanium |
| SMILES | C[NH+](C)CCCN1C(=O)C(=O)/C(=C(\O)c2ccc3c(c2)OCO3)[C@H]1c1cccnc1 |
| InChI | InChI=1S/C22H23N3O5/c1-24(2)9-4-10-25-19(15-5-3-8-23-12-15)18(21(27)22(25)28)20(26)14-6-7-16-17(11-14)30-13-29-16/h3,5-8,11-12,19,26H,4,9-10,13H2,1-2H3/p+1/b20-18-/t19-/m1/s1 |
| InChIKey | CZEFEGITKXZZGX-LAFOYAEKSA-O |
| XLogP | 0.77 |
| TPSA | 93.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|