C20H23N2O3S+ — CID 6988798
3-[(5S)-4-[hydroxy(phenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]propyl-dimethylazanium (PubChem CID 6988798) has the molecular formula C20H23N2O3S+ and a molecular weight of 371.48 g/mol. Its IUPAC name is 3-[(5S)-4-[hydroxy(phenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]propyl-dimethylazanium.
| Compound Name | 3-[(5S)-4-[hydroxy(phenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]propyl-dimethylazanium |
|---|---|
| PubChem CID | 6988798 |
| Molecular Formula | C20H23N2O3S+ |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 3-[(5S)-4-[hydroxy(phenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]propyl-dimethylazanium |
| SMILES | C[NH+](C)CCCN1C(=O)C(=O)C(=C(O)c2ccccc2)[C@H]1c1cccs1 |
| InChI | InChI=1S/C20H22N2O3S/c1-21(2)11-7-12-22-17(15-10-6-13-26-15)16(19(24)20(22)25)18(23)14-8-4-3-5-9-14/h3-6,8-10,13,17,23H,7,11-12H2,1-2H3/p+1/t17-/m1/s1 |
| InChIKey | LBCSFZRBWBXZHZ-QGZVFWFLSA-O |
| XLogP | 1.70 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|