C17H18N5O3+ — CID 3321511
6-(3,4-dimethylphenyl)-2,4-dimethyl-5,8-dihydropurino[7,8-a]imidazol-9-ium-1,3,7-trione (PubChem CID 3321511) has the molecular formula C17H18N5O3+ and a molecular weight of 340.36 g/mol. Its IUPAC name is 6-(3,4-dimethylphenyl)-2,4-dimethyl-5,8-dihydropurino[7,8-a]imidazol-9-ium-1,3,7-trione.
| Compound Name | 6-(3,4-dimethylphenyl)-2,4-dimethyl-5,8-dihydropurino[7,8-a]imidazol-9-ium-1,3,7-trione |
|---|---|
| PubChem CID | 3321511 |
| Molecular Formula | C17H18N5O3+ |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 6-(3,4-dimethylphenyl)-2,4-dimethyl-5,8-dihydropurino[7,8-a]imidazol-9-ium-1,3,7-trione |
| SMILES | Cc1ccc(N2C(=O)C[n+]3c2[nH]c2c3c(=O)n(C)c(=O)n2C)cc1C |
| InChI | InChI=1S/C17H17N5O3/c1-9-5-6-11(7-10(9)2)22-12(23)8-21-13-14(18-16(21)22)19(3)17(25)20(4)15(13)24/h5-7H,8H2,1-4H3/p+1 |
| InChIKey | JOJAAUIXDNLTMY-UHFFFAOYSA-O |
| XLogP | 0.15 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|