C27H32N5O2+ — CID 2027027
(7S)-9-(3,4-dimethylphenyl)-3-[(2,5-dimethylphenyl)methyl]-1,7-dimethyl-6,7,8,10-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione (PubChem CID 2027027) has the molecular formula C27H32N5O2+ and a molecular weight of 458.59 g/mol. Its IUPAC name is (7S)-9-(3,4-dimethylphenyl)-3-[(2,5-dimethylphenyl)methyl]-1,7-dimethyl-6,7,8,10-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione.
| Compound Name | (7S)-9-(3,4-dimethylphenyl)-3-[(2,5-dimethylphenyl)methyl]-1,7-dimethyl-6,7,8,10-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione |
|---|---|
| PubChem CID | 2027027 |
| Molecular Formula | C27H32N5O2+ |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | (7S)-9-(3,4-dimethylphenyl)-3-[(2,5-dimethylphenyl)methyl]-1,7-dimethyl-6,7,8,10-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione |
| SMILES | Cc1ccc(C)c(Cn2c(=O)c3c([nH]c4[n+]3C[C@@H](C)CN4c3ccc(C)c(C)c3)n(C)c2=O)c1 |
| InChI | InChI=1S/C27H31N5O2/c1-16-7-8-19(4)21(11-16)15-32-25(33)23-24(29(6)27(32)34)28-26-30(13-17(2)14-31(23)26)22-10-9-18(3)20(5)12-22/h7-12,17H,13-15H2,1-6H3/p+1/t17-/m0/s1 |
| InChIKey | VATNXEMYWYDXAG-KRWDZBQOSA-O |
| XLogP | 3.39 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|