C21H28N5O4+ — CID 2010900
(7S)-3-(2-ethoxyethyl)-9-(4-methoxyphenyl)-1,7-dimethyl-6,7,8,10-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione (PubChem CID 2010900) has the molecular formula C21H28N5O4+ and a molecular weight of 414.49 g/mol. Its IUPAC name is (7S)-3-(2-ethoxyethyl)-9-(4-methoxyphenyl)-1,7-dimethyl-6,7,8,10-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione.
| Compound Name | (7S)-3-(2-ethoxyethyl)-9-(4-methoxyphenyl)-1,7-dimethyl-6,7,8,10-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione |
|---|---|
| PubChem CID | 2010900 |
| Molecular Formula | C21H28N5O4+ |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | (7S)-3-(2-ethoxyethyl)-9-(4-methoxyphenyl)-1,7-dimethyl-6,7,8,10-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione |
| SMILES | CCOCCn1c(=O)c2c([nH]c3[n+]2C[C@@H](C)CN3c2ccc(OC)cc2)n(C)c1=O |
| InChI | InChI=1S/C21H27N5O4/c1-5-30-11-10-24-19(27)17-18(23(3)21(24)28)22-20-25(12-14(2)13-26(17)20)15-6-8-16(29-4)9-7-15/h6-9,14H,5,10-13H2,1-4H3/p+1/t14-/m0/s1 |
| InChIKey | JZONELJKZSYIAL-AWEZNQCLSA-O |
| XLogP | 1.15 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|