C22H30N5O2+ — CID 2015887
(7S)-3-butyl-9-(4-ethylphenyl)-1,7-dimethyl-6,7,8,10-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione (PubChem CID 2015887) has the molecular formula C22H30N5O2+ and a molecular weight of 396.52 g/mol. Its IUPAC name is (7S)-3-butyl-9-(4-ethylphenyl)-1,7-dimethyl-6,7,8,10-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione.
| Compound Name | (7S)-3-butyl-9-(4-ethylphenyl)-1,7-dimethyl-6,7,8,10-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione |
|---|---|
| PubChem CID | 2015887 |
| Molecular Formula | C22H30N5O2+ |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | (7S)-3-butyl-9-(4-ethylphenyl)-1,7-dimethyl-6,7,8,10-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione |
| SMILES | CCCCn1c(=O)c2c([nH]c3[n+]2C[C@@H](C)CN3c2ccc(CC)cc2)n(C)c1=O |
| InChI | InChI=1S/C22H29N5O2/c1-5-7-12-25-20(28)18-19(24(4)22(25)29)23-21-26(13-15(3)14-27(18)21)17-10-8-16(6-2)9-11-17/h8-11,15H,5-7,12-14H2,1-4H3/p+1/t15-/m0/s1 |
| InChIKey | IBSJHQSKFHNKMD-HNNXBMFYSA-O |
| XLogP | 2.47 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|