C21H28N5O3+ — CID 2030325
(7R)-3-(2-ethoxyethyl)-1,7-dimethyl-9-(4-methylphenyl)-6,7,8,10-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione (PubChem CID 2030325) has the molecular formula C21H28N5O3+ and a molecular weight of 398.49 g/mol. Its IUPAC name is (7R)-3-(2-ethoxyethyl)-1,7-dimethyl-9-(4-methylphenyl)-6,7,8,10-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione.
| Compound Name | (7R)-3-(2-ethoxyethyl)-1,7-dimethyl-9-(4-methylphenyl)-6,7,8,10-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione |
|---|---|
| PubChem CID | 2030325 |
| Molecular Formula | C21H28N5O3+ |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | (7R)-3-(2-ethoxyethyl)-1,7-dimethyl-9-(4-methylphenyl)-6,7,8,10-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione |
| SMILES | CCOCCn1c(=O)c2c([nH]c3[n+]2C[C@H](C)CN3c2ccc(C)cc2)n(C)c1=O |
| InChI | InChI=1S/C21H27N5O3/c1-5-29-11-10-24-19(27)17-18(23(4)21(24)28)22-20-25(12-15(3)13-26(17)20)16-8-6-14(2)7-9-16/h6-9,15H,5,10-13H2,1-4H3/p+1/t15-/m1/s1 |
| InChIKey | PPEAEOYYJCYCDS-OAHLLOKOSA-O |
| XLogP | 1.45 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|