C38H45ClF3NO4 — CID 3322881
[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-[5,13-dihydroxy-6,10-dimethyl-5-[[methyl(propyl)amino]methyl]-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone (PubChem CID 3322881) has the molecular formula C38H45ClF3NO4 and a molecular weight of 672.23 g/mol. Its IUPAC name is [5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-[5,13-dihydroxy-6,10-dimethyl-5-[[methyl(propyl)amino]methyl]-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone.
| Compound Name | [5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-[5,13-dihydroxy-6,10-dimethyl-5-[[methyl(propyl)amino]methyl]-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
|---|---|
| PubChem CID | 3322881 |
| Molecular Formula | C38H45ClF3NO4 |
| Molecular Weight | 672.23 g/mol |
| Exact Mass | 671.30 |
| IUPAC Name | [5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-[5,13-dihydroxy-6,10-dimethyl-5-[[methyl(propyl)amino]methyl]-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
| SMILES | CCCN(C)CC1(O)CCC2C34C=CC5(C=C3C(=O)c3ccc(-c6cc(C(F)(F)F)ccc6Cl)o3)CC(O)CCC5(C)C4CCC21C |
| InChI | InChI=1S/C38H45ClF3NO4/c1-5-18-43(4)22-36(46)15-12-31-34(36,3)14-11-30-33(2)13-10-24(44)20-35(33)16-17-37(30,31)26(21-35)32(45)29-9-8-28(47-29)25-19-23(38(40,41)42)6-7-27(25)39/h6-9,16-17,19,21,24,30-31,44,46H,5,10-15,18,20,22H2,1-4H3 |
| InChIKey | VLGBHTPSABSIMQ-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.23 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|