C30H27ClFN3O3 — CID 3323610
1-[4-[5-(4-chlorophenyl)-1-(3-fluorophenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-2-phenoxyethanone (PubChem CID 3323610) has the molecular formula C30H27ClFN3O3 and a molecular weight of 532.02 g/mol. Its IUPAC name is 1-[4-[5-(4-chlorophenyl)-1-(3-fluorophenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-2-phenoxyethanone.
| Compound Name | 1-[4-[5-(4-chlorophenyl)-1-(3-fluorophenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 3323610 |
| Molecular Formula | C30H27ClFN3O3 |
| Molecular Weight | 532.02 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | 1-[4-[5-(4-chlorophenyl)-1-(3-fluorophenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-2-phenoxyethanone |
| SMILES | Cc1c(C(=O)N2CCN(C(=O)COc3ccccc3)CC2)cc(-c2ccc(Cl)cc2)n1-c1cccc(F)c1 |
| InChI | InChI=1S/C30H27ClFN3O3/c1-21-27(19-28(22-10-12-23(31)13-11-22)35(21)25-7-5-6-24(32)18-25)30(37)34-16-14-33(15-17-34)29(36)20-38-26-8-3-2-4-9-26/h2-13,18-19H,14-17,20H2,1H3 |
| InChIKey | LYSNSOIWMQCOGE-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.02 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|