C19H26N6O2S — CID 3325325
N-[4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 3325325) has the molecular formula C19H26N6O2S and a molecular weight of 402.52 g/mol. Its IUPAC name is N-[4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-[4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 3325325 |
| Molecular Formula | C19H26N6O2S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | N-[4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | CC(C)C(=O)N1CCN(c2ccc(NC(=O)CSc3nncn3C)cc2)CC1 |
| InChI | InChI=1S/C19H26N6O2S/c1-14(2)18(27)25-10-8-24(9-11-25)16-6-4-15(5-7-16)21-17(26)12-28-19-22-20-13-23(19)3/h4-7,13-14H,8-12H2,1-3H3,(H,21,26) |
| InChIKey | NRBXLOBTRFUWHN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|