C20H29N5OS — CID 7894502
2-[(4-pentyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 7894502) has the molecular formula C20H29N5OS and a molecular weight of 387.55 g/mol. Its IUPAC name is 2-[(4-pentyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[(4-pentyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 7894502 |
| Molecular Formula | C20H29N5OS |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 2-[(4-pentyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | CCCCCn1cnnc1SCC(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H29N5OS/c1-2-3-5-14-25-16-21-23-20(25)27-15-19(26)22-17-8-10-18(11-9-17)24-12-6-4-7-13-24/h8-11,16H,2-7,12-15H2,1H3,(H,22,26) |
| InChIKey | BMOUJJSNCPEMLH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|