C17H31N5O2S — CID 35143895
N-(2-methyl-2-morpholin-4-ylpropyl)-2-[(4-pentyl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 35143895) has the molecular formula C17H31N5O2S and a molecular weight of 369.54 g/mol. Its IUPAC name is N-(2-methyl-2-morpholin-4-ylpropyl)-2-[(4-pentyl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(2-methyl-2-morpholin-4-ylpropyl)-2-[(4-pentyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 35143895 |
| Molecular Formula | C17H31N5O2S |
| Molecular Weight | 369.54 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | N-(2-methyl-2-morpholin-4-ylpropyl)-2-[(4-pentyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | CCCCCn1cnnc1SCC(=O)NCC(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C17H31N5O2S/c1-4-5-6-7-21-14-19-20-16(21)25-12-15(23)18-13-17(2,3)22-8-10-24-11-9-22/h14H,4-13H2,1-3H3,(H,18,23) |
| InChIKey | BWUWTRGDCIMNBL-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.54 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|