C21H30N4O3S — CID 34380670
N-(2-methyl-2-morpholin-4-ylpropyl)-2-(4-oxo-3-propylquinazolin-2-yl)sulfanylacetamide (PubChem CID 34380670) has the molecular formula C21H30N4O3S and a molecular weight of 418.56 g/mol. Its IUPAC name is N-(2-methyl-2-morpholin-4-ylpropyl)-2-(4-oxo-3-propylquinazolin-2-yl)sulfanylacetamide.
| Compound Name | N-(2-methyl-2-morpholin-4-ylpropyl)-2-(4-oxo-3-propylquinazolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 34380670 |
| Molecular Formula | C21H30N4O3S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N-(2-methyl-2-morpholin-4-ylpropyl)-2-(4-oxo-3-propylquinazolin-2-yl)sulfanylacetamide |
| SMILES | CCCn1c(SCC(=O)NCC(C)(C)N2CCOCC2)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H30N4O3S/c1-4-9-25-19(27)16-7-5-6-8-17(16)23-20(25)29-14-18(26)22-15-21(2,3)24-10-12-28-13-11-24/h5-8H,4,9-15H2,1-3H3,(H,22,26) |
| InChIKey | GAXDMFJELGOQOI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |