C15H7Br4ClN2O5 — CID 3327160
2,3,4,5-tetrabromo-6-[[(5-chloro-2-hydroxybenzoyl)amino]carbamoyl]benzoic acid (PubChem CID 3327160) has the molecular formula C15H7Br4ClN2O5 and a molecular weight of 650.30 g/mol. Its IUPAC name is 2,3,4,5-tetrabromo-6-[[(5-chloro-2-hydroxybenzoyl)amino]carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrabromo-6-[[(5-chloro-2-hydroxybenzoyl)amino]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 3327160 |
| Molecular Formula | C15H7Br4ClN2O5 |
| Molecular Weight | 650.30 g/mol |
| Exact Mass | 645.68 |
| IUPAC Name | 2,3,4,5-tetrabromo-6-[[(5-chloro-2-hydroxybenzoyl)amino]carbamoyl]benzoic acid |
| SMILES | O=C(NNC(=O)c1c(Br)c(Br)c(Br)c(Br)c1C(=O)O)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C15H7Br4ClN2O5/c16-9-7(8(15(26)27)10(17)12(19)11(9)18)14(25)22-21-13(24)5-3-4(20)1-2-6(5)23/h1-3,23H,(H,21,24)(H,22,25)(H,26,27) |
| InChIKey | UYAHTQNTKJLBMD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.30 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|