C18H15N3O2S — CID 33278412
3-[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl]thieno[3,2-d]pyrimidin-4-one (PubChem CID 33278412) has the molecular formula C18H15N3O2S and a molecular weight of 337.40 g/mol. Its IUPAC name is 3-[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl]thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl]thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 33278412 |
| Molecular Formula | C18H15N3O2S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 3-[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl]thieno[3,2-d]pyrimidin-4-one |
| SMILES | CCc1cccc2c(C(=O)Cn3cnc4ccsc4c3=O)c[nH]c12 |
| InChI | InChI=1S/C18H15N3O2S/c1-2-11-4-3-5-12-13(8-19-16(11)12)15(22)9-21-10-20-14-6-7-24-17(14)18(21)23/h3-8,10,19H,2,9H2,1H3 |
| InChIKey | LGLPXMHSEXJVEO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |