C20H17N3O2 — CID 7628285
3-[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl]quinazolin-4-one (PubChem CID 7628285) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 3-[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl]quinazolin-4-one.
| Compound Name | 3-[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 7628285 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 3-[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl]quinazolin-4-one |
| SMILES | CCc1cccc2c(C(=O)Cn3cnc4ccccc4c3=O)c[nH]c12 |
| InChI | InChI=1S/C20H17N3O2/c1-2-13-6-5-8-14-16(10-21-19(13)14)18(24)11-23-12-22-17-9-4-3-7-15(17)20(23)25/h3-10,12,21H,2,11H2,1H3 |
| InChIKey | JXNQEVQMQUXELI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |