C19H18ClN3O6 — CID 33286260
ethyl 3-[[2-(3-chloroanilino)-2-oxoethyl]-methylcarbamoyl]-5-nitrobenzoate (PubChem CID 33286260) has the molecular formula C19H18ClN3O6 and a molecular weight of 419.82 g/mol. Its IUPAC name is ethyl 3-[[2-(3-chloroanilino)-2-oxoethyl]-methylcarbamoyl]-5-nitrobenzoate.
| Compound Name | ethyl 3-[[2-(3-chloroanilino)-2-oxoethyl]-methylcarbamoyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 33286260 |
| Molecular Formula | C19H18ClN3O6 |
| Molecular Weight | 419.82 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | ethyl 3-[[2-(3-chloroanilino)-2-oxoethyl]-methylcarbamoyl]-5-nitrobenzoate |
| SMILES | CCOC(=O)c1cc(C(=O)N(C)CC(=O)Nc2cccc(Cl)c2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H18ClN3O6/c1-3-29-19(26)13-7-12(8-16(9-13)23(27)28)18(25)22(2)11-17(24)21-15-6-4-5-14(20)10-15/h4-10H,3,11H2,1-2H3,(H,21,24) |
| InChIKey | GBDCJGFNFSBCGO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.82 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|