C20H19Cl2N3O6 — CID 25313437
ethyl 3-[[2-(2,6-dichloroanilino)-2-oxoethyl]-ethylcarbamoyl]-5-nitrobenzoate (PubChem CID 25313437) has the molecular formula C20H19Cl2N3O6 and a molecular weight of 468.29 g/mol. Its IUPAC name is ethyl 3-[[2-(2,6-dichloroanilino)-2-oxoethyl]-ethylcarbamoyl]-5-nitrobenzoate.
| Compound Name | ethyl 3-[[2-(2,6-dichloroanilino)-2-oxoethyl]-ethylcarbamoyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 25313437 |
| Molecular Formula | C20H19Cl2N3O6 |
| Molecular Weight | 468.29 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | ethyl 3-[[2-(2,6-dichloroanilino)-2-oxoethyl]-ethylcarbamoyl]-5-nitrobenzoate |
| SMILES | CCOC(=O)c1cc(C(=O)N(CC)CC(=O)Nc2c(Cl)cccc2Cl)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H19Cl2N3O6/c1-3-24(11-17(26)23-18-15(21)6-5-7-16(18)22)19(27)12-8-13(20(28)31-4-2)10-14(9-12)25(29)30/h5-10H,3-4,11H2,1-2H3,(H,23,26) |
| InChIKey | ZJFGSSKSVWFXRU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.29 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|