C46H50O25 — CID 3328849
[3,4-diacetyloxy-6-[5-acetyloxy-2-(3,4-diacetyloxyphenyl)-7-methoxy-4-oxochromen-3-yl]oxy-5-(3,4,5-triacetyloxy-6-methyloxan-2-yl)oxyoxan-2-yl]methyl acetate (PubChem CID 3328849) has the molecular formula C46H50O25 and a molecular weight of 1002.88 g/mol. Its IUPAC name is [3,4-diacetyloxy-6-[5-acetyloxy-2-(3,4-diacetyloxyphenyl)-7-methoxy-4-oxochromen-3-yl]oxy-5-(3,4,5-triacetyloxy-6-methyloxan-2-yl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [3,4-diacetyloxy-6-[5-acetyloxy-2-(3,4-diacetyloxyphenyl)-7-methoxy-4-oxochromen-3-yl]oxy-5-(3,4,5-triacetyloxy-6-methyloxan-2-yl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 3328849 |
| Molecular Formula | C46H50O25 |
| Molecular Weight | 1002.88 g/mol |
| Exact Mass | 1002.26 |
| IUPAC Name | [3,4-diacetyloxy-6-[5-acetyloxy-2-(3,4-diacetyloxyphenyl)-7-methoxy-4-oxochromen-3-yl]oxy-5-(3,4,5-triacetyloxy-6-methyloxan-2-yl)oxyoxan-2-yl]methyl acetate |
| SMILES | COc1cc(OC(C)=O)c2c(=O)c(OC3OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C3OC3OC(C)C(OC(C)=O)C(OC(C)=O)C3OC(C)=O)c(-c3ccc(OC(C)=O)c(OC(C)=O)c3)oc2c1 |
| InChI | InChI=1S/C46H50O25/c1-18-37(63-23(6)51)41(65-25(8)53)43(67-27(10)55)45(59-18)71-44-42(66-26(9)54)39(64-24(7)52)34(17-58-19(2)47)69-46(44)70-40-36(56)35-32(62-22(5)50)15-29(57-11)16-33(35)68-38(40)28-12-13-30(60-20(3)48)31(14-28)61-21(4)49/h12-16,18,34,37,39,41-46H,17H2,1-11H3 |
| InChIKey | UTAUENQDYHLYLW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 313.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 25 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1002.88 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 25 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|