C44H48O23 — CID 4015509
[3,4-diacetyloxy-6-[5-acetyloxy-2-(4-acetyloxyphenyl)-7-methoxy-4-oxochromen-3-yl]oxy-5-(3,4,5-triacetyloxy-6-methyloxan-2-yl)oxyoxan-2-yl]methyl acetate (PubChem CID 4015509) has the molecular formula C44H48O23 and a molecular weight of 944.84 g/mol. Its IUPAC name is [3,4-diacetyloxy-6-[5-acetyloxy-2-(4-acetyloxyphenyl)-7-methoxy-4-oxochromen-3-yl]oxy-5-(3,4,5-triacetyloxy-6-methyloxan-2-yl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [3,4-diacetyloxy-6-[5-acetyloxy-2-(4-acetyloxyphenyl)-7-methoxy-4-oxochromen-3-yl]oxy-5-(3,4,5-triacetyloxy-6-methyloxan-2-yl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 4015509 |
| Molecular Formula | C44H48O23 |
| Molecular Weight | 944.84 g/mol |
| Exact Mass | 944.26 |
| IUPAC Name | [3,4-diacetyloxy-6-[5-acetyloxy-2-(4-acetyloxyphenyl)-7-methoxy-4-oxochromen-3-yl]oxy-5-(3,4,5-triacetyloxy-6-methyloxan-2-yl)oxyoxan-2-yl]methyl acetate |
| SMILES | COc1cc(OC(C)=O)c2c(=O)c(OC3OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C3OC3OC(C)C(OC(C)=O)C(OC(C)=O)C3OC(C)=O)c(-c3ccc(OC(C)=O)cc3)oc2c1 |
| InChI | InChI=1S/C44H48O23/c1-18-35(59-22(5)48)39(61-24(7)50)41(63-26(9)52)43(56-18)67-42-40(62-25(8)51)37(60-23(6)49)32(17-55-19(2)45)65-44(42)66-38-34(53)33-30(58-21(4)47)15-29(54-10)16-31(33)64-36(38)27-11-13-28(14-12-27)57-20(3)46/h11-16,18,32,35,37,39-44H,17H2,1-10H3 |
| InChIKey | QDZRUHCGEVYBFD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 286.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 23 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 944.84 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 23 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|