C20H32N2O2S — CID 33295067
N-[4-[[4-(2-methylbutan-2-yl)cyclohexyl]amino]-4-oxobutyl]thiophene-2-carboxamide (PubChem CID 33295067) has the molecular formula C20H32N2O2S and a molecular weight of 364.56 g/mol. Its IUPAC name is N-[4-[[4-(2-methylbutan-2-yl)cyclohexyl]amino]-4-oxobutyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[[4-(2-methylbutan-2-yl)cyclohexyl]amino]-4-oxobutyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 33295067 |
| Molecular Formula | C20H32N2O2S |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | N-[4-[[4-(2-methylbutan-2-yl)cyclohexyl]amino]-4-oxobutyl]thiophene-2-carboxamide |
| SMILES | CCC(C)(C)C1CCC(NC(=O)CCCNC(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C20H32N2O2S/c1-4-20(2,3)15-9-11-16(12-10-15)22-18(23)8-5-13-21-19(24)17-7-6-14-25-17/h6-7,14-16H,4-5,8-13H2,1-3H3,(H,21,24)(H,22,23) |
| InChIKey | RGHWLRHQWJOXLV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|