C19H31N3O2S — CID 26130837
(3S)-3-(carbamoylamino)-N-[4-(2-methylbutan-2-yl)cyclohexyl]-3-thiophen-2-ylpropanamide (PubChem CID 26130837) has the molecular formula C19H31N3O2S and a molecular weight of 365.54 g/mol. Its IUPAC name is (3S)-3-(carbamoylamino)-N-[4-(2-methylbutan-2-yl)cyclohexyl]-3-thiophen-2-ylpropanamide.
| Compound Name | (3S)-3-(carbamoylamino)-N-[4-(2-methylbutan-2-yl)cyclohexyl]-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 26130837 |
| Molecular Formula | C19H31N3O2S |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | (3S)-3-(carbamoylamino)-N-[4-(2-methylbutan-2-yl)cyclohexyl]-3-thiophen-2-ylpropanamide |
| SMILES | CCC(C)(C)C1CCC(NC(=O)C[C@H](NC(N)=O)c2cccs2)CC1 |
| InChI | InChI=1S/C19H31N3O2S/c1-4-19(2,3)13-7-9-14(10-8-13)21-17(23)12-15(22-18(20)24)16-6-5-11-25-16/h5-6,11,13-15H,4,7-10,12H2,1-3H3,(H,21,23)(H3,20,22,24)/t13?,14?,15-/m0/s1 |
| InChIKey | KMEJGFGQDUAQST-NRXISQOPSA-N |
| XLogP | 3.96 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |