C18H29N3O2S — CID 55931831
3-(carbamoylamino)-N-(5-methyl-2-propan-2-ylcyclohexyl)-3-thiophen-2-ylpropanamide (PubChem CID 55931831) has the molecular formula C18H29N3O2S and a molecular weight of 351.52 g/mol. Its IUPAC name is 3-(carbamoylamino)-N-(5-methyl-2-propan-2-ylcyclohexyl)-3-thiophen-2-ylpropanamide.
| Compound Name | 3-(carbamoylamino)-N-(5-methyl-2-propan-2-ylcyclohexyl)-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 55931831 |
| Molecular Formula | C18H29N3O2S |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 3-(carbamoylamino)-N-(5-methyl-2-propan-2-ylcyclohexyl)-3-thiophen-2-ylpropanamide |
| SMILES | CC1CCC(C(C)C)C(NC(=O)CC(NC(N)=O)c2cccs2)C1 |
| InChI | InChI=1S/C18H29N3O2S/c1-11(2)13-7-6-12(3)9-14(13)20-17(22)10-15(21-18(19)23)16-5-4-8-24-16/h4-5,8,11-15H,6-7,9-10H2,1-3H3,(H,20,22)(H3,19,21,23) |
| InChIKey | AWYYTCARRDBQGV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |