C10H15NOS — CID 3329561
4-(methoxymethylsulfanyl)-N,N-dimethylaniline (PubChem CID 3329561) has the molecular formula C10H15NOS and a molecular weight of 197.30 g/mol. Its IUPAC name is 4-(methoxymethylsulfanyl)-N,N-dimethylaniline.
| Compound Name | 4-(methoxymethylsulfanyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 3329561 |
| Molecular Formula | C10H15NOS |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 4-(methoxymethylsulfanyl)-N,N-dimethylaniline |
| SMILES | COCSc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C10H15NOS/c1-11(2)9-4-6-10(7-5-9)13-8-12-3/h4-7H,8H2,1-3H3 |
| InChIKey | BEJQZMXHPMXCPS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|